About 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one
1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 99770605) has the molecular formula C13H15F3N2O2
and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 99770605 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | C[C@@H](C(=O)/C=C/N(C)C)n1cc(C(F)(F)F)ccc1=O |
| InChI | InChI=1S/C13H15F3N2O2/c1-9(11(19)6-7-17(2)3)18-8-10(13(14,15)16)4-5-12(18)20/h4-9H,1-3H3/b7-6+/t9-/m0/s1 |
| InChIKey | LARVYCQAUIFSAJ-UCUJLANTSA-N |
| XLogP | 2.07 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one (CID 99770605) is 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one is C[C@@H](C(=O)/C=C/N(C)C)n1cc(C(F)(F)F)ccc1=O.
What is the InChIKey of 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is LARVYCQAUIFSAJ-UCUJLANTSA-N. The full InChI is InChI=1S/C13H15F3N2O2/c1-9(11(19)6-7-17(2)3)18-8-10(13(14,15)16)4-5-12(18)20/h4-9H,1-3H3/b7-6+/t9-/m0/s1.
What are the key properties of 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one?
1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 288.27 g/mol, XLogP of 2.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E,2S)-5-(dimethylamino)-3-oxopent-4-en-2-yl]-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 99770605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).