About (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol
(5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol (PubChem CID 99771467) has the molecular formula C14H26OSi
and a molecular weight of 238.45 g/mol. Its IUPAC name is (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol.
Molecular Properties
| Compound Name | (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol |
| PubChem CID | 99771467 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol |
| SMILES | C=CCC[C@@H](O)C(C)(C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C14H26OSi/c1-7-8-10-13(15)14(2,3)11-9-12-16(4,5)6/h7,13,15H,1,8,10-11H2,2-6H3/t13-/m1/s1 |
| InChIKey | VUQMSLNZKHUGHZ-CYBMUJFWSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol?
The IUPAC name of (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol (CID 99771467) is (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol.
What is the SMILES notation for (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol?
The canonical SMILES for (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol is C=CCC[C@@H](O)C(C)(C)CC#C[Si](C)(C)C.
What is the InChIKey of (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol?
The InChIKey is VUQMSLNZKHUGHZ-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H26OSi/c1-7-8-10-13(15)14(2,3)11-9-12-16(4,5)6/h7,13,15H,1,8,10-11H2,2-6H3/t13-/m1/s1.
What are the key properties of (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol?
(5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol has a molecular weight of 238.45 g/mol, XLogP of 3.61, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-6,6-dimethyl-9-trimethylsilylnon-1-en-8-yn-5-ol is sourced from PubChem (CID 99771467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).