C20H34O3Si — CID 99771657
(1R,4S,9R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-4-hydroxytricyclo[7.4.1.01,6]tetradec-5-en-12-one (PubChem CID 99771657) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (1R,4S,9R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-4-hydroxytricyclo[7.4.1.01,6]tetradec-5-en-12-one.
| Compound Name | (1R,4S,9R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-4-hydroxytricyclo[7.4.1.01,6]tetradec-5-en-12-one |
|---|---|
| PubChem CID | 99771657 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (1R,4S,9R,14R)-14-[tert-butyl(dimethyl)silyl]oxy-4-hydroxytricyclo[7.4.1.01,6]tetradec-5-en-12-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H]2CCC(=O)C[C@@]13CC[C@H](O)C=C3CC2 |
| InChI | InChI=1S/C20H34O3Si/c1-19(2,3)24(4,5)23-18-14-6-8-15-12-16(21)10-11-20(15,18)13-17(22)9-7-14/h12,14,16,18,21H,6-11,13H2,1-5H3/t14-,16+,18-,20-/m1/s1 |
| InChIKey | LVULAKOIKJUWQX-IHMNZUQTSA-N |
| XLogP | 4.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|