C25H44OSi — CID 99771691
[(4S,4aR,5R,6S,8aR)-4-but-3-enyl-3,4a,6-trimethyl-5-(3-methylbut-3-enyl)-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane (PubChem CID 99771691) has the molecular formula C25H44OSi and a molecular weight of 388.71 g/mol. Its IUPAC name is [(4S,4aR,5R,6S,8aR)-4-but-3-enyl-3,4a,6-trimethyl-5-(3-methylbut-3-enyl)-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane.
| Compound Name | [(4S,4aR,5R,6S,8aR)-4-but-3-enyl-3,4a,6-trimethyl-5-(3-methylbut-3-enyl)-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 99771691 |
| Molecular Formula | C25H44OSi |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | [(4S,4aR,5R,6S,8aR)-4-but-3-enyl-3,4a,6-trimethyl-5-(3-methylbut-3-enyl)-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-trimethylsilane |
| SMILES | C=CCC[C@@H]1C(C)=C(O[Si](C)(C)C)C[C@H]2CC[C@H](C)[C@@H](CCC(=C)C)[C@@]21C |
| InChI | InChI=1S/C25H44OSi/c1-10-11-12-23-20(5)24(26-27(7,8)9)17-21-15-14-19(4)22(25(21,23)6)16-13-18(2)3/h10,19,21-23H,1-2,11-17H2,3-9H3/t19-,21+,22+,23+,25+/m0/s1 |
| InChIKey | XIMIJVFNHYZRJD-ANYFMGCHSA-N |
| XLogP | 8.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|