C21H38O5Si — CID 99771717
dimethyl 2-[2-[(1S,2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-1,6-dimethylcyclohex-3-en-1-yl]ethyl]propanedioate (PubChem CID 99771717) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is dimethyl 2-[2-[(1S,2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-1,6-dimethylcyclohex-3-en-1-yl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-[(1S,2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-1,6-dimethylcyclohex-3-en-1-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 99771717 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | dimethyl 2-[2-[(1S,2S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-1,6-dimethylcyclohex-3-en-1-yl]ethyl]propanedioate |
| SMILES | COC(=O)C(CC[C@@]1(C)[C@H](C)CC=C[C@@H]1O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C21H38O5Si/c1-15-11-10-12-17(26-27(8,9)20(2,3)4)21(15,5)14-13-16(18(22)24-6)19(23)25-7/h10,12,15-17H,11,13-14H2,1-9H3/t15-,17+,21+/m1/s1 |
| InChIKey | AKZHYBFPFHTOAU-KUDFPVQQSA-N |
| XLogP | 4.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|