C26H40O4SSi — CID 99771724
(1R,3S,6S,8R,10S)-1-(benzenesulfonyl)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,10-dimethyltricyclo[6.3.0.03,6]undecan-2-one (PubChem CID 99771724) has the molecular formula C26H40O4SSi and a molecular weight of 476.76 g/mol. Its IUPAC name is (1R,3S,6S,8R,10S)-1-(benzenesulfonyl)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,10-dimethyltricyclo[6.3.0.03,6]undecan-2-one.
| Compound Name | (1R,3S,6S,8R,10S)-1-(benzenesulfonyl)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,10-dimethyltricyclo[6.3.0.03,6]undecan-2-one |
|---|---|
| PubChem CID | 99771724 |
| Molecular Formula | C26H40O4SSi |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (1R,3S,6S,8R,10S)-1-(benzenesulfonyl)-10-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,10-dimethyltricyclo[6.3.0.03,6]undecan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]1(C)C[C@H]2C[C@]3(C)CC[C@@H]3C(=O)[C@@]2(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C26H40O4SSi/c1-23(2,3)32(6,7)30-18-24(4)15-19-16-25(5)14-13-21(25)22(27)26(19,17-24)31(28,29)20-11-9-8-10-12-20/h8-12,19,21H,13-18H2,1-7H3/t19-,21+,24-,25-,26+/m0/s1 |
| InChIKey | PFUPTZIVMZGJPG-GDHDYFBOSA-N |
| XLogP | 6.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|