C13H22OSi — CID 99771830
[(1S,5R,6R,7R)-7-ethenyl-7-methyl-6-bicyclo[3.2.0]hept-2-enyl]oxy-trimethylsilane (PubChem CID 99771830) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is [(1S,5R,6R,7R)-7-ethenyl-7-methyl-6-bicyclo[3.2.0]hept-2-enyl]oxy-trimethylsilane.
| Compound Name | [(1S,5R,6R,7R)-7-ethenyl-7-methyl-6-bicyclo[3.2.0]hept-2-enyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 99771830 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | [(1S,5R,6R,7R)-7-ethenyl-7-methyl-6-bicyclo[3.2.0]hept-2-enyl]oxy-trimethylsilane |
| SMILES | C=C[C@@]1(C)[C@H](O[Si](C)(C)C)[C@@H]2CC=C[C@@H]21 |
| InChI | InChI=1S/C13H22OSi/c1-6-13(2)11-9-7-8-10(11)12(13)14-15(3,4)5/h6-7,9-12H,1,8H2,2-5H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | MOWYEHRFZQNBOD-YVECIDJPSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|