C23H40O2Si — CID 99772110
(1R,2R,4S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 99772110) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is (1R,2R,4S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 99772110 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (1R,2R,4S)-2-[(3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C=C[C@@]12CC[C@@H](C[C@@]1(O)C1=C[C@H](O[Si](C)(C)C(C)(C)C)CCC1)C2(C)C |
| InChI | InChI=1S/C23H40O2Si/c1-9-22-14-13-18(21(22,5)6)16-23(22,24)17-11-10-12-19(15-17)25-26(7,8)20(2,3)4/h9,15,18-19,24H,1,10-14,16H2,2-8H3/t18-,19+,22-,23+/m0/s1 |
| InChIKey | FHDSLSJYUUVTNU-JFSTXAPLSA-N |
| XLogP | 6.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|