C26H44O5Si — CID 99772113
(1S,3R,5S,8R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-ene-4,9-dione (PubChem CID 99772113) has the molecular formula C26H44O5Si and a molecular weight of 464.72 g/mol. Its IUPAC name is (1S,3R,5S,8R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-ene-4,9-dione.
| Compound Name | (1S,3R,5S,8R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-ene-4,9-dione |
|---|---|
| PubChem CID | 99772113 |
| Molecular Formula | C26H44O5Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (1S,3R,5S,8R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-ene-4,9-dione |
| SMILES | COCO[C@H]1CC[C@@]2(C)C(=O)C[C@H]3CC=C(O[Si](C)(C)C(C)(C)C)[C@@H](C[C@H]2C1=O)C3(C)C |
| InChI | InChI=1S/C26H44O5Si/c1-24(2,3)32(8,9)31-20-11-10-17-14-22(27)26(6)13-12-21(30-16-29-7)23(28)19(26)15-18(20)25(17,4)5/h11,17-19,21H,10,12-16H2,1-9H3/t17-,18-,19+,21+,26-/m1/s1 |
| InChIKey | DQBVXOXRRPLNFM-YTMISCLOSA-N |
| XLogP | 5.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|