C30H54O8Si — CID 99772154
(1R,3S,5S,8R,9R,10R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5,9,10-tris(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-en-4-one (PubChem CID 99772154) has the molecular formula C30H54O8Si and a molecular weight of 570.84 g/mol. Its IUPAC name is (1R,3S,5S,8R,9R,10R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5,9,10-tris(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-en-4-one.
| Compound Name | (1R,3S,5S,8R,9R,10R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5,9,10-tris(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-en-4-one |
|---|---|
| PubChem CID | 99772154 |
| Molecular Formula | C30H54O8Si |
| Molecular Weight | 570.84 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | (1R,3S,5S,8R,9R,10R,11R)-14-[tert-butyl(dimethyl)silyl]oxy-5,9,10-tris(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-en-4-one |
| SMILES | COCO[C@@H]1[C@@H]2CC=C(O[Si](C)(C)C(C)(C)C)[C@H](C[C@@H]3C(=O)[C@@H](OCOC)CC[C@@]3(C)[C@H]1OCOC)C2(C)C |
| InChI | InChI=1S/C30H54O8Si/c1-28(2,3)39(10,11)38-23-13-12-20-26(36-18-33-8)27(37-19-34-9)30(6)15-14-24(35-17-32-7)25(31)22(30)16-21(23)29(20,4)5/h13,20-22,24,26-27H,12,14-19H2,1-11H3/t20-,21-,22+,24-,26+,27-,30+/m0/s1 |
| InChIKey | DLYUDWWANRDVEE-RFNPCLAZSA-N |
| XLogP | 5.91 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.84 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|