C25H34O3Si — CID 99772245
2-[(1R,7R,8R,12R)-12-methyl-3,3-diphenyl-2,4-dioxa-3-silabicyclo[5.5.0]dodecan-8-yl]propan-2-ol (PubChem CID 99772245) has the molecular formula C25H34O3Si and a molecular weight of 410.63 g/mol. Its IUPAC name is 2-[(1R,7R,8R,12R)-12-methyl-3,3-diphenyl-2,4-dioxa-3-silabicyclo[5.5.0]dodecan-8-yl]propan-2-ol.
| Compound Name | 2-[(1R,7R,8R,12R)-12-methyl-3,3-diphenyl-2,4-dioxa-3-silabicyclo[5.5.0]dodecan-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 99772245 |
| Molecular Formula | C25H34O3Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[(1R,7R,8R,12R)-12-methyl-3,3-diphenyl-2,4-dioxa-3-silabicyclo[5.5.0]dodecan-8-yl]propan-2-ol |
| SMILES | C[C@@H]1CCC[C@@H](C(C)(C)O)[C@H]2CCO[Si](c3ccccc3)(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C25H34O3Si/c1-19-11-10-16-23(25(2,3)26)22-17-18-27-29(28-24(19)22,20-12-6-4-7-13-20)21-14-8-5-9-15-21/h4-9,12-15,19,22-24,26H,10-11,16-18H2,1-3H3/t19-,22-,23-,24-/m1/s1 |
| InChIKey | NBZMUASANRNDIA-OTUUDDROSA-N |
| XLogP | 3.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|