C23H48O3Si2 — CID 99772338
tri(propan-2-yl)-[[(3R,4S)-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane (PubChem CID 99772338) has the molecular formula C23H48O3Si2 and a molecular weight of 428.81 g/mol. Its IUPAC name is tri(propan-2-yl)-[[(3R,4S)-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane.
| Compound Name | tri(propan-2-yl)-[[(3R,4S)-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane |
|---|---|
| PubChem CID | 99772338 |
| Molecular Formula | C23H48O3Si2 |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | tri(propan-2-yl)-[[(3R,4S)-3-tri(propan-2-yl)silyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane |
| SMILES | CC(C)[Si](O[C@H]1C=COC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H48O3Si2/c1-16(2)27(17(3)4,18(5)6)25-22-13-14-24-15-23(22)26-28(19(7)8,20(9)10)21(11)12/h13-14,16-23H,15H2,1-12H3/t22-,23+/m0/s1 |
| InChIKey | MKMPZBFQTKBEIC-XZOQPEGZSA-N |
| XLogP | 7.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|