C28H56O4Si2 — CID 99772342
1-[(3R,4R)-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-6-yl]cyclopentan-1-ol (PubChem CID 99772342) has the molecular formula C28H56O4Si2 and a molecular weight of 512.92 g/mol. Its IUPAC name is 1-[(3R,4R)-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-6-yl]cyclopentan-1-ol.
| Compound Name | 1-[(3R,4R)-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-6-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 99772342 |
| Molecular Formula | C28H56O4Si2 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | 1-[(3R,4R)-3,4-bis[tri(propan-2-yl)silyloxy]-3,4-dihydro-2H-pyran-6-yl]cyclopentan-1-ol |
| SMILES | CC(C)[Si](O[C@@H]1C=C(C2(O)CCCC2)OC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H56O4Si2/c1-19(2)33(20(3)4,21(5)6)31-25-17-27(28(29)15-13-14-16-28)30-18-26(25)32-34(22(7)8,23(9)10)24(11)12/h17,19-26,29H,13-16,18H2,1-12H3/t25-,26-/m1/s1 |
| InChIKey | QVPHCTZOKXAQFI-CLJLJLNGSA-N |
| XLogP | 8.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|