C26H50O5Si2 — CID 99772381
(1R,2R,3R,7S,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradecan-5-one (PubChem CID 99772381) has the molecular formula C26H50O5Si2 and a molecular weight of 498.85 g/mol. Its IUPAC name is (1R,2R,3R,7S,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradecan-5-one.
| Compound Name | (1R,2R,3R,7S,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradecan-5-one |
|---|---|
| PubChem CID | 99772381 |
| Molecular Formula | C26H50O5Si2 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | (1R,2R,3R,7S,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-methyl-2-(2-trimethylsilylethoxymethoxy)-4-oxatricyclo[8.3.1.03,7]tetradecan-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@]2(C)C[C@H]1CC[C@H]1CC(=O)O[C@H]1[C@@H]2OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C26H50O5Si2/c1-25(2,3)33(8,9)31-21-12-13-26(4)17-20(21)11-10-19-16-22(27)30-23(19)24(26)29-18-28-14-15-32(5,6)7/h19-21,23-24H,10-18H2,1-9H3/t19-,20+,21+,23+,24-,26+/m0/s1 |
| InChIKey | IUPUBPPNXIUWNE-FPAATCSKSA-N |
| XLogP | 6.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|