C14H24O2Si — CID 99772779
(1R,3R,4R)-1-ethenyl-7,7-dimethyl-3-trimethylsilyloxybicyclo[2.2.1]heptan-2-one (PubChem CID 99772779) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is (1R,3R,4R)-1-ethenyl-7,7-dimethyl-3-trimethylsilyloxybicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3R,4R)-1-ethenyl-7,7-dimethyl-3-trimethylsilyloxybicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 99772779 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (1R,3R,4R)-1-ethenyl-7,7-dimethyl-3-trimethylsilyloxybicyclo[2.2.1]heptan-2-one |
| SMILES | C=C[C@@]12CC[C@@H]([C@@H](O[Si](C)(C)C)C1=O)C2(C)C |
| InChI | InChI=1S/C14H24O2Si/c1-7-14-9-8-10(13(14,2)3)11(12(14)15)16-17(4,5)6/h7,10-11H,1,8-9H2,2-6H3/t10-,11+,14+/m0/s1 |
| InChIKey | WTWIXWBEIDDRPR-MISXGVKJSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|