C20H30O5SSi — CID 99772816
(3R,5R,9S)-3-(benzenesulfonyl)-9-[tert-butyl(dimethyl)silyl]oxy-1-oxaspiro[4.4]nonan-2-one (PubChem CID 99772816) has the molecular formula C20H30O5SSi and a molecular weight of 410.61 g/mol. Its IUPAC name is (3R,5R,9S)-3-(benzenesulfonyl)-9-[tert-butyl(dimethyl)silyl]oxy-1-oxaspiro[4.4]nonan-2-one.
| Compound Name | (3R,5R,9S)-3-(benzenesulfonyl)-9-[tert-butyl(dimethyl)silyl]oxy-1-oxaspiro[4.4]nonan-2-one |
|---|---|
| PubChem CID | 99772816 |
| Molecular Formula | C20H30O5SSi |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (3R,5R,9S)-3-(benzenesulfonyl)-9-[tert-butyl(dimethyl)silyl]oxy-1-oxaspiro[4.4]nonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@@]12C[C@@H](S(=O)(=O)c1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C20H30O5SSi/c1-19(2,3)27(4,5)25-17-12-9-13-20(17)14-16(18(21)24-20)26(22,23)15-10-7-6-8-11-15/h6-8,10-11,16-17H,9,12-14H2,1-5H3/t16-,17+,20-/m1/s1 |
| InChIKey | QKUQZZSGDZJVTN-FUHIMQAGSA-N |
| XLogP | 4.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|