About (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide
(2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide (PubChem CID 99773803) has the molecular formula C15H16F2N4O2
and a molecular weight of 322.32 g/mol. Its IUPAC name is (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide.
Molecular Properties
| Compound Name | (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide |
| PubChem CID | 99773803 |
| Molecular Formula | C15H16F2N4O2 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide |
| SMILES | O=C(NCc1ccn[nH]1)N1CCO[C@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H16F2N4O2/c16-12-2-1-10(7-13(12)17)14-9-21(5-6-23-14)15(22)18-8-11-3-4-19-20-11/h1-4,7,14H,5-6,8-9H2,(H,18,22)(H,19,20)/t14-/m0/s1 |
| InChIKey | FXUVFWBPMMNSCQ-AWEZNQCLSA-N |
| XLogP | 1.97 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide?
The IUPAC name of (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide (CID 99773803) is (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide.
What is the SMILES notation for (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide?
The canonical SMILES for (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide is O=C(NCc1ccn[nH]1)N1CCO[C@H](c2ccc(F)c(F)c2)C1.
What is the InChIKey of (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide?
The InChIKey is FXUVFWBPMMNSCQ-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H16F2N4O2/c16-12-2-1-10(7-13(12)17)14-9-21(5-6-23-14)15(22)18-8-11-3-4-19-20-11/h1-4,7,14H,5-6,8-9H2,(H,18,22)(H,19,20)/t14-/m0/s1.
What are the key properties of (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide?
(2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide has a molecular weight of 322.32 g/mol, XLogP of 1.97, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,4-difluorophenyl)-N-(1H-pyrazol-5-ylmethyl)morpholine-4-carboxamide is sourced from PubChem (CID 99773803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).