C19H32N2O3 — CID 99774273
(3R)-1-cycloheptyl-N-[(2S)-2-cyclopentyl-2-hydroxyethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 99774273) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is (3R)-1-cycloheptyl-N-[(2S)-2-cyclopentyl-2-hydroxyethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-cycloheptyl-N-[(2S)-2-cyclopentyl-2-hydroxyethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 99774273 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | (3R)-1-cycloheptyl-N-[(2S)-2-cyclopentyl-2-hydroxyethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NC[C@@H](O)C1CCCC1)[C@@H]1CC(=O)N(C2CCCCCC2)C1 |
| InChI | InChI=1S/C19H32N2O3/c22-17(14-7-5-6-8-14)12-20-19(24)15-11-18(23)21(13-15)16-9-3-1-2-4-10-16/h14-17,22H,1-13H2,(H,20,24)/t15-,17-/m1/s1 |
| InChIKey | DBANMBCNRBSGNK-NVXWUHKLSA-N |
| XLogP | 2.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |