C15H26N4OSi — CID 99774369
(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-([1,2,4]triazolo[1,5-a]pyridin-6-yl)propan-2-amine (PubChem CID 99774369) has the molecular formula C15H26N4OSi and a molecular weight of 306.49 g/mol. Its IUPAC name is (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-([1,2,4]triazolo[1,5-a]pyridin-6-yl)propan-2-amine.
| Compound Name | (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-([1,2,4]triazolo[1,5-a]pyridin-6-yl)propan-2-amine |
|---|---|
| PubChem CID | 99774369 |
| Molecular Formula | C15H26N4OSi |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-1-([1,2,4]triazolo[1,5-a]pyridin-6-yl)propan-2-amine |
| SMILES | C[C@@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccc2ncnn2c1 |
| InChI | InChI=1S/C15H26N4OSi/c1-11(16)14(20-21(5,6)15(2,3)4)12-7-8-13-17-10-18-19(13)9-12/h7-11,14H,16H2,1-6H3/t11-,14-/m1/s1 |
| InChIKey | JHBRAZISIANUQD-BXUZGUMPSA-N |
| XLogP | 3.14 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|