About N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide
N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide (PubChem CID 99774640) has the molecular formula C12H23NO3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide |
| PubChem CID | 99774640 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide |
| SMILES | CCO[C@H]1C[C@H](N(C)S(=O)(=O)C2CC2)C1(C)C |
| InChI | InChI=1S/C12H23NO3S/c1-5-16-11-8-10(12(11,2)3)13(4)17(14,15)9-6-7-9/h9-11H,5-8H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | OBCKWDWIGSXNDN-QWRGUYRKSA-N |
| XLogP | 1.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide?
The IUPAC name of N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide (CID 99774640) is N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide.
What is the SMILES notation for N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide?
The canonical SMILES for N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide is CCO[C@H]1C[C@H](N(C)S(=O)(=O)C2CC2)C1(C)C.
What is the InChIKey of N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide?
The InChIKey is OBCKWDWIGSXNDN-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H23NO3S/c1-5-16-11-8-10(12(11,2)3)13(4)17(14,15)9-6-7-9/h9-11H,5-8H2,1-4H3/t10-,11-/m0/s1.
What are the key properties of N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide?
N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide has a molecular weight of 261.39 g/mol, XLogP of 1.61, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,3S)-3-ethoxy-2,2-dimethylcyclobutyl]-N-methylcyclopropanesulfonamide is sourced from PubChem (CID 99774640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).