C14H20BNO4 — CID 99774994
(2R)-2-amino-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid (PubChem CID 99774994) has the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. Its IUPAC name is (2R)-2-amino-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid.
| Compound Name | (2R)-2-amino-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 99774994 |
| Molecular Formula | C14H20BNO4 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (2R)-2-amino-2-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
| SMILES | CC1(C)OB(c2ccccc2[C@@H](N)C(=O)O)OC1(C)C |
| InChI | InChI=1S/C14H20BNO4/c1-13(2)14(3,4)20-15(19-13)10-8-6-5-7-9(10)11(16)12(17)18/h5-8,11H,16H2,1-4H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | ADRDMPXTLRPJRL-LLVKDONJSA-N |
| XLogP | 1.07 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|