C13H13F2N3O3S — CID 99775167
3-(4-fluorophenyl)-N-(3-fluoropropylsulfonyl)-1H-pyrazole-5-carboxamide (PubChem CID 99775167) has the molecular formula C13H13F2N3O3S and a molecular weight of 329.33 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(3-fluoropropylsulfonyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-(3-fluoropropylsulfonyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 99775167 |
| Molecular Formula | C13H13F2N3O3S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(3-fluoropropylsulfonyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NS(=O)(=O)CCCF)c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C13H13F2N3O3S/c14-6-1-7-22(20,21)18-13(19)12-8-11(16-17-12)9-2-4-10(15)5-3-9/h2-5,8H,1,6-7H2,(H,16,17)(H,18,19) |
| InChIKey | DZVYGCPXITVQRS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |