About 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide
5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide (PubChem CID 99775768) has the molecular formula C17H20N2O2S
and a molecular weight of 316.43 g/mol. Its IUPAC name is 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide |
| PubChem CID | 99775768 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(CNC[C@H]2CCO[C@H]2c2ccccc2)s1 |
| InChI | InChI=1S/C17H20N2O2S/c18-17(20)15-7-6-14(22-15)11-19-10-13-8-9-21-16(13)12-4-2-1-3-5-12/h1-7,13,16,19H,8-11H2,(H2,18,20)/t13-,16+/m1/s1 |
| InChIKey | OGQAMSNSPTXZSR-CJNGLKHVSA-N |
| XLogP | 2.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide?
The IUPAC name of 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide (CID 99775768) is 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide.
What is the SMILES notation for 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide?
The canonical SMILES for 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide is NC(=O)c1ccc(CNC[C@H]2CCO[C@H]2c2ccccc2)s1.
What is the InChIKey of 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide?
The InChIKey is OGQAMSNSPTXZSR-CJNGLKHVSA-N. The full InChI is InChI=1S/C17H20N2O2S/c18-17(20)15-7-6-14(22-15)11-19-10-13-8-9-21-16(13)12-4-2-1-3-5-12/h1-7,13,16,19H,8-11H2,(H2,18,20)/t13-,16+/m1/s1.
What are the key properties of 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide?
5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide has a molecular weight of 316.43 g/mol, XLogP of 2.71, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[[(2R,3R)-2-phenyloxolan-3-yl]methylamino]methyl]thiophene-2-carboxamide is sourced from PubChem (CID 99775768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).