C16H22N2O2 — CID 99777059
(3R)-N-[(3S,4S)-4-methoxypyrrolidin-3-yl]-3-phenylpent-4-enamide (PubChem CID 99777059) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (3R)-N-[(3S,4S)-4-methoxypyrrolidin-3-yl]-3-phenylpent-4-enamide.
| Compound Name | (3R)-N-[(3S,4S)-4-methoxypyrrolidin-3-yl]-3-phenylpent-4-enamide |
|---|---|
| PubChem CID | 99777059 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (3R)-N-[(3S,4S)-4-methoxypyrrolidin-3-yl]-3-phenylpent-4-enamide |
| SMILES | C=C[C@@H](CC(=O)N[C@H]1CNC[C@@H]1OC)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O2/c1-3-12(13-7-5-4-6-8-13)9-16(19)18-14-10-17-11-15(14)20-2/h3-8,12,14-15,17H,1,9-11H2,2H3,(H,18,19)/t12-,14-,15-/m0/s1 |
| InChIKey | MYZKKPLDCIWCRH-QEJZJMRPSA-N |
| XLogP | 1.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|