C18H22BrN3O2 — CID 99777518
1-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-(5-bromo-2-methyl-1H-indol-3-yl)ethanone (PubChem CID 99777518) has the molecular formula C18H22BrN3O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 1-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-(5-bromo-2-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 1-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-(5-bromo-2-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 99777518 |
| Molecular Formula | C18H22BrN3O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-(5-bromo-2-methyl-1H-indol-3-yl)ethanone |
| SMILES | Cc1[nH]c2ccc(Br)cc2c1CC(=O)N1CCN2CCOC[C@@H]2C1 |
| InChI | InChI=1S/C18H22BrN3O2/c1-12-15(16-8-13(19)2-3-17(16)20-12)9-18(23)22-5-4-21-6-7-24-11-14(21)10-22/h2-3,8,14,20H,4-7,9-11H2,1H3/t14-/m0/s1 |
| InChIKey | YIXZPTXTPBCFRG-AWEZNQCLSA-N |
| XLogP | 2.32 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|