C19H21N3O3 — CID 99778149
2-[(1S,3R)-3-[(3-methyl-1,2-oxazol-5-yl)methylamino]cyclohexyl]isoindole-1,3-dione (PubChem CID 99778149) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-[(1S,3R)-3-[(3-methyl-1,2-oxazol-5-yl)methylamino]cyclohexyl]isoindole-1,3-dione.
| Compound Name | 2-[(1S,3R)-3-[(3-methyl-1,2-oxazol-5-yl)methylamino]cyclohexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 99778149 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[(1S,3R)-3-[(3-methyl-1,2-oxazol-5-yl)methylamino]cyclohexyl]isoindole-1,3-dione |
| SMILES | Cc1cc(CN[C@@H]2CCC[C@H](N3C(=O)c4ccccc4C3=O)C2)on1 |
| InChI | InChI=1S/C19H21N3O3/c1-12-9-15(25-21-12)11-20-13-5-4-6-14(10-13)22-18(23)16-7-2-3-8-17(16)19(22)24/h2-3,7-9,13-14,20H,4-6,10-11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | LAJAOLFICCEKMI-KGLIPLIRSA-N |
| XLogP | 2.68 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|