C16H19FN4OS — CID 99779305
N-(4-fluorophenyl)-2-[(3S)-3-(1-methylpyrazol-4-yl)thiomorpholin-4-yl]acetamide (PubChem CID 99779305) has the molecular formula C16H19FN4OS and a molecular weight of 334.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(3S)-3-(1-methylpyrazol-4-yl)thiomorpholin-4-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(3S)-3-(1-methylpyrazol-4-yl)thiomorpholin-4-yl]acetamide |
|---|---|
| PubChem CID | 99779305 |
| Molecular Formula | C16H19FN4OS |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(3S)-3-(1-methylpyrazol-4-yl)thiomorpholin-4-yl]acetamide |
| SMILES | Cn1cc([C@H]2CSCCN2CC(=O)Nc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C16H19FN4OS/c1-20-9-12(8-18-20)15-11-23-7-6-21(15)10-16(22)19-14-4-2-13(17)3-5-14/h2-5,8-9,15H,6-7,10-11H2,1H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | OVURLBFKYZZTIN-OAHLLOKOSA-N |
| XLogP | 2.29 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |