C13H21B2NO6 — CID 99779896
6-methyl-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 99779896) has the molecular formula C13H21B2NO6 and a molecular weight of 308.94 g/mol. Its IUPAC name is 6-methyl-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-methyl-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 99779896 |
| Molecular Formula | C13H21B2NO6 |
| Molecular Weight | 308.94 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 6-methyl-2-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(/C=C/B2OC(C)(C)C(C)(C)O2)OC(=O)C1 |
| InChI | InChI=1S/C13H21B2NO6/c1-12(2)13(3,4)22-15(21-12)7-6-14-19-10(17)8-16(5)9-11(18)20-14/h6-7H,8-9H2,1-5H3/b7-6+ |
| InChIKey | MVTNIQCFWSPASI-VOTSOKGWSA-N |
| XLogP | 0.23 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.94 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|