C15H20ClN — CID 99780755
N-[(1R)-1-(3-chlorophenyl)propyl]hex-5-yn-1-amine (PubChem CID 99780755) has the molecular formula C15H20ClN and a molecular weight of 249.78 g/mol. Its IUPAC name is N-[(1R)-1-(3-chlorophenyl)propyl]hex-5-yn-1-amine.
| Compound Name | N-[(1R)-1-(3-chlorophenyl)propyl]hex-5-yn-1-amine |
|---|---|
| PubChem CID | 99780755 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-[(1R)-1-(3-chlorophenyl)propyl]hex-5-yn-1-amine |
| SMILES | C#CCCCCN[C@H](CC)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H20ClN/c1-3-5-6-7-11-17-15(4-2)13-9-8-10-14(16)12-13/h1,8-10,12,15,17H,4-7,11H2,2H3/t15-/m1/s1 |
| InChIKey | RLRKFOUAIDRNOE-OAHLLOKOSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|