About tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate
tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate (PubChem CID 99780847) has the molecular formula C22H33N3O4
and a molecular weight of 403.52 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate |
| PubChem CID | 99780847 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate |
| SMILES | CC(=O)N(C)c1ccc(NC(=O)[C@]2(C)CCCC[C@H]2NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H33N3O4/c1-15(26)25(6)17-12-10-16(11-13-17)23-19(27)22(5)14-8-7-9-18(22)24-20(28)29-21(2,3)4/h10-13,18H,7-9,14H2,1-6H3,(H,23,27)(H,24,28)/t18-,22-/m1/s1 |
| InChIKey | IJXRAPBVYJWIHA-XMSQKQJNSA-N |
| XLogP | 4.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate?
The IUPAC name of tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate (CID 99780847) is tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate?
The canonical SMILES for tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate is CC(=O)N(C)c1ccc(NC(=O)[C@]2(C)CCCC[C@H]2NC(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate?
The InChIKey is IJXRAPBVYJWIHA-XMSQKQJNSA-N. The full InChI is InChI=1S/C22H33N3O4/c1-15(26)25(6)17-12-10-16(11-13-17)23-19(27)22(5)14-8-7-9-18(22)24-20(28)29-21(2,3)4/h10-13,18H,7-9,14H2,1-6H3,(H,23,27)(H,24,28)/t18-,22-/m1/s1.
What are the key properties of tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate?
tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate has a molecular weight of 403.52 g/mol, XLogP of 4.08, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1R,2R)-2-[[4-[acetyl(methyl)amino]phenyl]carbamoyl]-2-methylcyclohexyl]carbamate is sourced from PubChem (CID 99780847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).