About [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate
[(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate (PubChem CID 99781157) has the molecular formula C14H13ClFN3O3
and a molecular weight of 325.73 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate.
Molecular Properties
| Compound Name | [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate |
| PubChem CID | 99781157 |
| Molecular Formula | C14H13ClFN3O3 |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate |
| SMILES | O=C(OC[C@H]1CCOC1)c1cn(-c2cccc(Cl)c2F)nn1 |
| InChI | InChI=1S/C14H13ClFN3O3/c15-10-2-1-3-12(13(10)16)19-6-11(17-18-19)14(20)22-8-9-4-5-21-7-9/h1-3,6,9H,4-5,7-8H2/t9-/m0/s1 |
| InChIKey | FKQAXZKVUGDGSR-VIFPVBQESA-N |
| XLogP | 2.25 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate?
The IUPAC name of [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate (CID 99781157) is [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate.
What is the SMILES notation for [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate?
The canonical SMILES for [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate is O=C(OC[C@H]1CCOC1)c1cn(-c2cccc(Cl)c2F)nn1.
What is the InChIKey of [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate?
The InChIKey is FKQAXZKVUGDGSR-VIFPVBQESA-N. The full InChI is InChI=1S/C14H13ClFN3O3/c15-10-2-1-3-12(13(10)16)19-6-11(17-18-19)14(20)22-8-9-4-5-21-7-9/h1-3,6,9H,4-5,7-8H2/t9-/m0/s1.
What are the key properties of [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate?
[(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate has a molecular weight of 325.73 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-oxolan-3-yl]methyl 1-(3-chloro-2-fluorophenyl)triazole-4-carboxylate is sourced from PubChem (CID 99781157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).