C11H14N4O2 — CID 99781573
(8aR)-2-(1H-pyrazol-5-ylmethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 99781573) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is (8aR)-2-(1H-pyrazol-5-ylmethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | (8aR)-2-(1H-pyrazol-5-ylmethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 99781573 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (8aR)-2-(1H-pyrazol-5-ylmethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | O=C1[C@H]2CCCCN2C(=O)N1Cc1ccn[nH]1 |
| InChI | InChI=1S/C11H14N4O2/c16-10-9-3-1-2-6-14(9)11(17)15(10)7-8-4-5-12-13-8/h4-5,9H,1-3,6-7H2,(H,12,13)/t9-/m1/s1 |
| InChIKey | RNFHEURHTLAEPG-SECBINFHSA-N |
| XLogP | 0.73 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|