C21H29N3O4S — CID 99782255
4-[[2-[(1R,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 99782255) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is 4-[[2-[(1R,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]acetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-[(1R,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]acetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 99782255 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 4-[[2-[(1R,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)CN2[C@@H]3C[C@H]4CC[C@@]3(CS2(=O)=O)C4(C)C)cc1 |
| InChI | InChI=1S/C21H29N3O4S/c1-20(2)15-9-10-21(20)13-29(27,28)24(17(21)11-15)12-18(25)22-16-7-5-14(6-8-16)19(26)23(3)4/h5-8,15,17H,9-13H2,1-4H3,(H,22,25)/t15-,17-,21+/m1/s1 |
| InChIKey | LUKFGJFRYGQGGP-CEQIKUNHSA-N |
| XLogP | 2.17 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |