C18H27N3O5S — CID 99782295
2-methyl-2-[[2-(piperidin-1-ylsulfonylmethyl)phenyl]methylcarbamoylamino]propanoic acid (PubChem CID 99782295) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-methyl-2-[[2-(piperidin-1-ylsulfonylmethyl)phenyl]methylcarbamoylamino]propanoic acid.
| Compound Name | 2-methyl-2-[[2-(piperidin-1-ylsulfonylmethyl)phenyl]methylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 99782295 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-methyl-2-[[2-(piperidin-1-ylsulfonylmethyl)phenyl]methylcarbamoylamino]propanoic acid |
| SMILES | CC(C)(NC(=O)NCc1ccccc1CS(=O)(=O)N1CCCCC1)C(=O)O |
| InChI | InChI=1S/C18H27N3O5S/c1-18(2,16(22)23)20-17(24)19-12-14-8-4-5-9-15(14)13-27(25,26)21-10-6-3-7-11-21/h4-5,8-9H,3,6-7,10-13H2,1-2H3,(H,22,23)(H2,19,20,24) |
| InChIKey | DLLBHWRJAWKRBZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |