C23H27F3N4O — CID 99782746
(1R)-N-[(4-hexoxyphenyl)methyl]-1-(1H-1,2,4-triazol-5-yl)-1-[3-(trifluoromethyl)phenyl]methanamine (PubChem CID 99782746) has the molecular formula C23H27F3N4O and a molecular weight of 432.49 g/mol. Its IUPAC name is (1R)-N-[(4-hexoxyphenyl)methyl]-1-(1H-1,2,4-triazol-5-yl)-1-[3-(trifluoromethyl)phenyl]methanamine.
| Compound Name | (1R)-N-[(4-hexoxyphenyl)methyl]-1-(1H-1,2,4-triazol-5-yl)-1-[3-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 99782746 |
| Molecular Formula | C23H27F3N4O |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (1R)-N-[(4-hexoxyphenyl)methyl]-1-(1H-1,2,4-triazol-5-yl)-1-[3-(trifluoromethyl)phenyl]methanamine |
| SMILES | CCCCCCOc1ccc(CN[C@H](c2cccc(C(F)(F)F)c2)c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C23H27F3N4O/c1-2-3-4-5-13-31-20-11-9-17(10-12-20)15-27-21(22-28-16-29-30-22)18-7-6-8-19(14-18)23(24,25)26/h6-12,14,16,21,27H,2-5,13,15H2,1H3,(H,28,29,30)/t21-/m1/s1 |
| InChIKey | LOQZCIXDNYJZAR-OAQYLSRUSA-N |
| XLogP | 5.66 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|