C18H25NO2 — CID 99784868
(2S)-N-[[1-[(R)-hydroxy(phenyl)methyl]cyclopropyl]methyl]-2,4-dimethylpent-4-enamide (PubChem CID 99784868) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (2S)-N-[[1-[(R)-hydroxy(phenyl)methyl]cyclopropyl]methyl]-2,4-dimethylpent-4-enamide.
| Compound Name | (2S)-N-[[1-[(R)-hydroxy(phenyl)methyl]cyclopropyl]methyl]-2,4-dimethylpent-4-enamide |
|---|---|
| PubChem CID | 99784868 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (2S)-N-[[1-[(R)-hydroxy(phenyl)methyl]cyclopropyl]methyl]-2,4-dimethylpent-4-enamide |
| SMILES | C=C(C)C[C@H](C)C(=O)NCC1([C@H](O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H25NO2/c1-13(2)11-14(3)17(21)19-12-18(9-10-18)16(20)15-7-5-4-6-8-15/h4-8,14,16,20H,1,9-12H2,2-3H3,(H,19,21)/t14-,16+/m0/s1 |
| InChIKey | AYOQDGJVDCRHMG-GOEBONIOSA-N |
| XLogP | 3.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|