C13H19N3O — CID 99785429
1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-ethylurea (PubChem CID 99785429) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-ethylurea.
| Compound Name | 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-ethylurea |
|---|---|
| PubChem CID | 99785429 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-[2-(1,3-dihydroisoindol-2-yl)ethyl]-3-ethylurea |
| SMILES | CCNC(=O)NCCN1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H19N3O/c1-2-14-13(17)15-7-8-16-9-11-5-3-4-6-12(11)10-16/h3-6H,2,7-10H2,1H3,(H2,14,15,17) |
| InChIKey | RISPKVWDDBQWCR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |