About 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole
4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole (PubChem CID 99785747) has the molecular formula C18H19FN2O2S
and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole |
| PubChem CID | 99785747 |
| Molecular Formula | C18H19FN2O2S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole |
| SMILES | CO[C@@H](C)c1nc(COc2c(C)c(C)nc3ccc(F)cc23)cs1 |
| InChI | InChI=1S/C18H19FN2O2S/c1-10-11(2)20-16-6-5-13(19)7-15(16)17(10)23-8-14-9-24-18(21-14)12(3)22-4/h5-7,9,12H,8H2,1-4H3/t12-/m0/s1 |
| InChIKey | SRLFTJVECPNMHK-LBPRGKRZSA-N |
| XLogP | 4.73 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole?
The IUPAC name of 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole (CID 99785747) is 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole.
What is the SMILES notation for 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole?
The canonical SMILES for 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole is CO[C@@H](C)c1nc(COc2c(C)c(C)nc3ccc(F)cc23)cs1.
What is the InChIKey of 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole?
The InChIKey is SRLFTJVECPNMHK-LBPRGKRZSA-N. The full InChI is InChI=1S/C18H19FN2O2S/c1-10-11(2)20-16-6-5-13(19)7-15(16)17(10)23-8-14-9-24-18(21-14)12(3)22-4/h5-7,9,12H,8H2,1-4H3/t12-/m0/s1.
What are the key properties of 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole?
4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole has a molecular weight of 346.43 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-fluoro-2,3-dimethylquinolin-4-yl)oxymethyl]-2-[(1S)-1-methoxyethyl]-1,3-thiazole is sourced from PubChem (CID 99785747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).