C15H20N6O2S — CID 99786597
(2S)-N-(cyclohexylcarbamoyl)-2-(7H-purin-8-ylsulfanyl)propanamide (PubChem CID 99786597) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is (2S)-N-(cyclohexylcarbamoyl)-2-(7H-purin-8-ylsulfanyl)propanamide.
| Compound Name | (2S)-N-(cyclohexylcarbamoyl)-2-(7H-purin-8-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 99786597 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (2S)-N-(cyclohexylcarbamoyl)-2-(7H-purin-8-ylsulfanyl)propanamide |
| SMILES | C[C@H](Sc1nc2ncncc2[nH]1)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H20N6O2S/c1-9(24-15-19-11-7-16-8-17-12(11)20-15)13(22)21-14(23)18-10-5-3-2-4-6-10/h7-10H,2-6H2,1H3,(H,16,17,19,20)(H2,18,21,22,23)/t9-/m0/s1 |
| InChIKey | TWDGJYMPHHBVLR-VIFPVBQESA-N |
| XLogP | 1.99 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |