C16H21NO3 — CID 99786810
cyclopropyl-[(2S)-4-[(3-methoxyphenyl)methyl]morpholin-2-yl]methanone (PubChem CID 99786810) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is cyclopropyl-[(2S)-4-[(3-methoxyphenyl)methyl]morpholin-2-yl]methanone.
| Compound Name | cyclopropyl-[(2S)-4-[(3-methoxyphenyl)methyl]morpholin-2-yl]methanone |
|---|---|
| PubChem CID | 99786810 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | cyclopropyl-[(2S)-4-[(3-methoxyphenyl)methyl]morpholin-2-yl]methanone |
| SMILES | COc1cccc(CN2CCO[C@H](C(=O)C3CC3)C2)c1 |
| InChI | InChI=1S/C16H21NO3/c1-19-14-4-2-3-12(9-14)10-17-7-8-20-15(11-17)16(18)13-5-6-13/h2-4,9,13,15H,5-8,10-11H2,1H3/t15-/m0/s1 |
| InChIKey | DLCFLHASODFHAY-HNNXBMFYSA-N |
| XLogP | 1.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |