C20H35N3O2 — CID 99786973
(2S)-2-[4-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperazin-1-yl]-1-morpholin-4-ylpropan-1-one (PubChem CID 99786973) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is (2S)-2-[4-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperazin-1-yl]-1-morpholin-4-ylpropan-1-one.
| Compound Name | (2S)-2-[4-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperazin-1-yl]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 99786973 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | (2S)-2-[4-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]piperazin-1-yl]-1-morpholin-4-ylpropan-1-one |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CN1CCN([C@@H](C)C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C20H35N3O2/c1-16-5-4-6-17(2)19(16)15-21-7-9-22(10-8-21)18(3)20(24)23-11-13-25-14-12-23/h5,17-19H,4,6-15H2,1-3H3/t17-,18-,19+/m0/s1 |
| InChIKey | SMRIUUKNHQXQDV-GBESFXJTSA-N |
| XLogP | 1.84 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|