About 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea
3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea (PubChem CID 99788548) has the molecular formula C18H23N3OS
and a molecular weight of 329.47 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea.
Molecular Properties
| Compound Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea |
| PubChem CID | 99788548 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea |
| SMILES | Cc1nc(CNC(=O)N(C)CC2(c3ccccc3)CC2)sc1C |
| InChI | InChI=1S/C18H23N3OS/c1-13-14(2)23-16(20-13)11-19-17(22)21(3)12-18(9-10-18)15-7-5-4-6-8-15/h4-8H,9-12H2,1-3H3,(H,19,22) |
| InChIKey | WPJDBWOODBIWLU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea?
The IUPAC name of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea (CID 99788548) is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea.
What is the SMILES notation for 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea?
The canonical SMILES for 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea is Cc1nc(CNC(=O)N(C)CC2(c3ccccc3)CC2)sc1C.
What is the InChIKey of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea?
The InChIKey is WPJDBWOODBIWLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3OS/c1-13-14(2)23-16(20-13)11-19-17(22)21(3)12-18(9-10-18)15-7-5-4-6-8-15/h4-8H,9-12H2,1-3H3,(H,19,22).
What are the key properties of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea?
3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea has a molecular weight of 329.47 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-methyl-1-[(1-phenylcyclopropyl)methyl]urea is sourced from PubChem (CID 99788548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).