C20H22N4O — CID 99788867
N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]quinoxalin-2-amine (PubChem CID 99788867) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]quinoxalin-2-amine.
| Compound Name | N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]quinoxalin-2-amine |
|---|---|
| PubChem CID | 99788867 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]quinoxalin-2-amine |
| SMILES | C[C@@H]1CN(c2ccc(Nc3cnc4ccccc4n3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H22N4O/c1-14-12-24(13-15(2)25-14)17-9-7-16(8-10-17)22-20-11-21-18-5-3-4-6-19(18)23-20/h3-11,14-15H,12-13H2,1-2H3,(H,22,23)/t14-,15+ |
| InChIKey | NDHXFOVZWBYLLN-GASCZTMLSA-N |
| XLogP | 3.99 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|