C19H21BrFN3O2 — CID 99788894
N-[(2-bromo-4-fluorophenyl)methoxy]-2-[(2S)-2-methylpiperidin-1-yl]pyridine-4-carboxamide (PubChem CID 99788894) has the molecular formula C19H21BrFN3O2 and a molecular weight of 422.30 g/mol. Its IUPAC name is N-[(2-bromo-4-fluorophenyl)methoxy]-2-[(2S)-2-methylpiperidin-1-yl]pyridine-4-carboxamide.
| Compound Name | N-[(2-bromo-4-fluorophenyl)methoxy]-2-[(2S)-2-methylpiperidin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 99788894 |
| Molecular Formula | C19H21BrFN3O2 |
| Molecular Weight | 422.30 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | N-[(2-bromo-4-fluorophenyl)methoxy]-2-[(2S)-2-methylpiperidin-1-yl]pyridine-4-carboxamide |
| SMILES | C[C@H]1CCCCN1c1cc(C(=O)NOCc2ccc(F)cc2Br)ccn1 |
| InChI | InChI=1S/C19H21BrFN3O2/c1-13-4-2-3-9-24(13)18-10-14(7-8-22-18)19(25)23-26-12-15-5-6-16(21)11-17(15)20/h5-8,10-11,13H,2-4,9,12H2,1H3,(H,23,25)/t13-/m0/s1 |
| InChIKey | ZDLPFXHCKVUHGH-ZDUSSCGKSA-N |
| XLogP | 4.22 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|