C12H17N3O2 — CID 99789755
oxazinan-2-yl(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone (PubChem CID 99789755) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is oxazinan-2-yl(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone.
| Compound Name | oxazinan-2-yl(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 99789755 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | oxazinan-2-yl(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2c1CCCC2)N1CCCCO1 |
| InChI | InChI=1S/C12H17N3O2/c16-12(15-7-3-4-8-17-15)11-9-5-1-2-6-10(9)13-14-11/h1-8H2,(H,13,14) |
| InChIKey | GYNLEBDESWMVNX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |