About (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine
(2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine (PubChem CID 99790188) has the molecular formula C17H28N2O3S
and a molecular weight of 340.49 g/mol. Its IUPAC name is (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine |
| PubChem CID | 99790188 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine |
| SMILES | CCS(=O)(=O)c1ccc(N2C[C@@H](C)N(CCOC)[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C17H28N2O3S/c1-5-23(20,21)17-8-6-16(7-9-17)18-12-14(2)19(10-11-22-4)15(3)13-18/h6-9,14-15H,5,10-13H2,1-4H3/t14-,15+ |
| InChIKey | QFAQEVVMKHXHHO-GASCZTMLSA-N |
| XLogP | 2.03 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine?
The IUPAC name of (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine (CID 99790188) is (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine.
What is the SMILES notation for (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine?
The canonical SMILES for (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine is CCS(=O)(=O)c1ccc(N2C[C@@H](C)N(CCOC)[C@@H](C)C2)cc1.
What is the InChIKey of (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine?
The InChIKey is QFAQEVVMKHXHHO-GASCZTMLSA-N. The full InChI is InChI=1S/C17H28N2O3S/c1-5-23(20,21)17-8-6-16(7-9-17)18-12-14(2)19(10-11-22-4)15(3)13-18/h6-9,14-15H,5,10-13H2,1-4H3/t14-,15+.
What are the key properties of (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine?
(2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine has a molecular weight of 340.49 g/mol, XLogP of 2.03, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-(4-ethylsulfonylphenyl)-1-(2-methoxyethyl)-2,6-dimethylpiperazine is sourced from PubChem (CID 99790188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).