About (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide
(2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide (PubChem CID 99790505) has the molecular formula C15H20FN3O2
and a molecular weight of 293.34 g/mol. Its IUPAC name is (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide.
Molecular Properties
| Compound Name | (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide |
| PubChem CID | 99790505 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide |
| SMILES | CN(C(=O)N1CCCC[C@]1(C)C(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H20FN3O2/c1-15(13(17)20)9-3-4-10-19(15)14(21)18(2)12-7-5-11(16)6-8-12/h5-8H,3-4,9-10H2,1-2H3,(H2,17,20)/t15-/m1/s1 |
| InChIKey | HXPTZYPOKMGAOS-OAHLLOKOSA-N |
| XLogP | 2.11 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide?
The IUPAC name of (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide (CID 99790505) is (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide.
What is the SMILES notation for (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide?
The canonical SMILES for (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide is CN(C(=O)N1CCCC[C@]1(C)C(N)=O)c1ccc(F)cc1.
What is the InChIKey of (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide?
The InChIKey is HXPTZYPOKMGAOS-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H20FN3O2/c1-15(13(17)20)9-3-4-10-19(15)14(21)18(2)12-7-5-11(16)6-8-12/h5-8H,3-4,9-10H2,1-2H3,(H2,17,20)/t15-/m1/s1.
What are the key properties of (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide?
(2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide has a molecular weight of 293.34 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-N-(4-fluorophenyl)-1-N,2-dimethylpiperidine-1,2-dicarboxamide is sourced from PubChem (CID 99790505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).