C15H20F2N4O3 — CID 99790641
(2-amino-5-nitrophenyl)-[(3S)-4-(2,2-difluoroethyl)-3-ethylpiperazin-1-yl]methanone (PubChem CID 99790641) has the molecular formula C15H20F2N4O3 and a molecular weight of 342.35 g/mol. Its IUPAC name is (2-amino-5-nitrophenyl)-[(3S)-4-(2,2-difluoroethyl)-3-ethylpiperazin-1-yl]methanone.
| Compound Name | (2-amino-5-nitrophenyl)-[(3S)-4-(2,2-difluoroethyl)-3-ethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 99790641 |
| Molecular Formula | C15H20F2N4O3 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (2-amino-5-nitrophenyl)-[(3S)-4-(2,2-difluoroethyl)-3-ethylpiperazin-1-yl]methanone |
| SMILES | CC[C@H]1CN(C(=O)c2cc([N+](=O)[O-])ccc2N)CCN1CC(F)F |
| InChI | InChI=1S/C15H20F2N4O3/c1-2-10-8-20(6-5-19(10)9-14(16)17)15(22)12-7-11(21(23)24)3-4-13(12)18/h3-4,7,10,14H,2,5-6,8-9,18H2,1H3/t10-/m0/s1 |
| InChIKey | URHWYNRNIXUUML-JTQLQIEISA-N |
| XLogP | 1.98 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|