C11H24N2O2S2 — CID 99790709
N-[2-[[(1R,2S)-2-ethylsulfanylcyclohexyl]amino]ethyl]methanesulfonamide (PubChem CID 99790709) has the molecular formula C11H24N2O2S2 and a molecular weight of 280.46 g/mol. Its IUPAC name is N-[2-[[(1R,2S)-2-ethylsulfanylcyclohexyl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[(1R,2S)-2-ethylsulfanylcyclohexyl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 99790709 |
| Molecular Formula | C11H24N2O2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-[2-[[(1R,2S)-2-ethylsulfanylcyclohexyl]amino]ethyl]methanesulfonamide |
| SMILES | CCS[C@H]1CCCC[C@H]1NCCNS(C)(=O)=O |
| InChI | InChI=1S/C11H24N2O2S2/c1-3-16-11-7-5-4-6-10(11)12-8-9-13-17(2,14)15/h10-13H,3-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | HGVJWDMTLMLQOB-MNOVXSKESA-N |
| XLogP | 1.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|