C19H21ClN2O3S — CID 99791163
N-[(1S)-1-(5-chloro-2-pyridinyl)ethyl]-4-cyclopentylsulfonylbenzamide (PubChem CID 99791163) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is N-[(1S)-1-(5-chloro-2-pyridinyl)ethyl]-4-cyclopentylsulfonylbenzamide.
| Compound Name | N-[(1S)-1-(5-chloro-2-pyridinyl)ethyl]-4-cyclopentylsulfonylbenzamide |
|---|---|
| PubChem CID | 99791163 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[(1S)-1-(5-chloro-2-pyridinyl)ethyl]-4-cyclopentylsulfonylbenzamide |
| SMILES | C[C@H](NC(=O)c1ccc(S(=O)(=O)C2CCCC2)cc1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C19H21ClN2O3S/c1-13(18-11-8-15(20)12-21-18)22-19(23)14-6-9-17(10-7-14)26(24,25)16-4-2-3-5-16/h6-13,16H,2-5H2,1H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | BWPTVCQGYOJCEJ-ZDUSSCGKSA-N |
| XLogP | 3.94 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |